6-(3,4-Dimethoxyphenyl)-7,8-dihydronaphtho[2,3-d][1,3]dioxol-5(6H)-one O-acetyloxime structure
|
Common Name | 6-(3,4-Dimethoxyphenyl)-7,8-dihydronaphtho[2,3-d][1,3]dioxol-5(6H)-one O-acetyloxime | ||
|---|---|---|---|---|
| CAS Number | 54785-15-8 | Molecular Weight | 383.39500 | |
| Density | 1.32g/cm3 | Boiling Point | 532.1ºC at 760 mmHg | |
| Molecular Formula | C21H21NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.6ºC | |
| Name | [(E)-[6-(3,4-dimethoxyphenyl)-7,8-dihydro-6H-benzo[f][1,3]benzodioxol-5-ylidene]amino] acetate |
|---|
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 532.1ºC at 760 mmHg |
| Molecular Formula | C21H21NO6 |
| Molecular Weight | 383.39500 |
| Flash Point | 217.6ºC |
| Exact Mass | 383.13700 |
| PSA | 75.58000 |
| LogP | 3.42970 |
| Index of Refraction | 1.606 |
| InChIKey | ZLNILMHQBVKPMC-QURGRASLSA-N |
| SMILES | COc1ccc(C2CCc3cc4c(cc3C2=NOC(C)=O)OCO4)cc1OC |
|
~%
6-(3,4-Dimethox... CAS#:54785-15-8 |
| Literature: Gopinath et al. Journal of the Chemical Society, 1959 , p. 4012 |
|
~%
6-(3,4-Dimethox... CAS#:54785-15-8 |
| Literature: Gopinath et al. Journal of the Chemical Society, 1959 , p. 4012 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |