2-prop-2-enoxy-1,3,5-tris(prop-2-enyl)benzene
Modify Date: 2025-08-25 15:47:38
2-prop-2-enoxy-1,3,5-tris(prop-2-enyl)benzene structure
|
Common Name | 2-prop-2-enoxy-1,3,5-tris(prop-2-enyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 41388-81-2 | Molecular Weight | 254.36700 | |
| Density | 0.926g/cm3 | Boiling Point | 336.888ºC at 760 mmHg | |
| Molecular Formula | C18H22O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 133.296ºC | |
| Name | 2-prop-2-enoxy-1,3,5-tris(prop-2-enyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 0.926g/cm3 |
|---|---|
| Boiling Point | 336.888ºC at 760 mmHg |
| Molecular Formula | C18H22O |
| Molecular Weight | 254.36700 |
| Flash Point | 133.296ºC |
| Exact Mass | 254.16700 |
| PSA | 9.23000 |
| LogP | 4.43690 |
| Index of Refraction | 1.521 |
| InChIKey | WFLUNZJVDSSRMV-UHFFFAOYSA-N |
| SMILES | C=CCOc1c(CC=C)cc(CC=C)cc1CC=C |
| HS Code | 2909309090 |
|---|
|
~%
2-prop-2-enoxy-... CAS#:41388-81-2 |
| Literature: Davis,A.A.; Hunter,R.F. Journal of the Chemical Society, 1960 , p. 888 - 889 |
|
~%
2-prop-2-enoxy-... CAS#:41388-81-2 |
| Literature: Borgulya,J. et al. Helvetica Chimica Acta, 1973 , vol. 56, # 1 p. 14 - 75 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Allyl-2,4,6-triallyl-phenyl-aether |
| Benzene,1,3,5-tri-2-propen-1-yl-2-(2-propen-1-yloxy) |
| Ether,allyl2,4,6-triallylphenyl (6CI) |
| Benzene,1,3,5-tri-2-propenyl-2-(2-propenyloxy)-(9CI) |
| (2,4,6-Triallyl-phenyl)-allyl-ether |
| Allyl 2,4,6-triallylphenyl ether |