2-methyl-5-oxo-1-phenylpyrazole-3-carboxylic acid structure
|
Common Name | 2-methyl-5-oxo-1-phenylpyrazole-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 41405-77-0 | Molecular Weight | 218.20900 | |
| Density | 1.407g/cm3 | Boiling Point | 355.7ºC at 760mmHg | |
| Molecular Formula | C11H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.9ºC | |
| Name | 2-methyl-5-oxo-1-phenylpyrazole-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.407g/cm3 |
|---|---|
| Boiling Point | 355.7ºC at 760mmHg |
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 218.20900 |
| Flash Point | 168.9ºC |
| Exact Mass | 218.06900 |
| PSA | 64.23000 |
| LogP | 0.87420 |
| Index of Refraction | 1.641 |
| InChIKey | OIHMJESJURQMDG-UHFFFAOYSA-N |
| SMILES | Cn1c(C(=O)O)cc(=O)n1-c1ccccc1 |
| HS Code | 2933199090 |
|---|
|
~%
2-methyl-5-oxo-... CAS#:41405-77-0 |
| Literature: Bodendorf; Popelak Justus Liebigs Annalen der Chemie, 1950 , vol. 566, p. 84,88 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Pyrazole-3-carboxylicacid,2,5-dihydro-2-methyl-5-oxo-1-phenyl |
| 2-Methyl-5-oxo-1-phenyl-2,5-dihydro-1H-pyrazol-3-carbonsaeure |
| 3-Pyrazoline-3-carboxylicacid,2-methyl-5-oxo-1-phenyl-(7CI) |
| 3-Carboxyantipyrine |
| 2-Methyl-5-oxo-1-phenyl-3-pyrazolin-3-carboxylic acid |
| 2-methyl-5-oxo-1-phenyl-2,5-dihydro-1H-pyrazole-3-carboxylic acid |
| 3-Carboxyantipyrin |
| 2,5-Dihydro-2-methyl-5-oxo-1-phenyl-1H-pyrazole-3-carboxylic acid |
| 1-Phenyl-2-methyl-5-pyrazolon-3-carbonsaeure |