5-Oxo-1-phenyl-2,5-dihydro-1H-pyrazole-3-carboxylic acid structure
|
Common Name | 5-Oxo-1-phenyl-2,5-dihydro-1H-pyrazole-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 49597-17-3 | Molecular Weight | 204.18200 | |
| Density | 1.458g/cm3 | Boiling Point | 358.775ºC at 760 mmHg | |
| Molecular Formula | C10H8N2O3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 170.782ºC | |
| Name | 3-oxo-2-phenyl-1H-pyrazole-5-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.458g/cm3 |
|---|---|
| Boiling Point | 358.775ºC at 760 mmHg |
| Molecular Formula | C10H8N2O3 |
| Molecular Weight | 204.18200 |
| Flash Point | 170.782ºC |
| Exact Mass | 204.05300 |
| PSA | 75.09000 |
| LogP | 0.86380 |
| Index of Refraction | 1.649 |
| InChIKey | SIVDWYOIVRKZPG-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(=O)n(-c2ccccc2)[nH]1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933199090 |
| Precursor 8 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Oxo-1-phenyl-2,5-dihydro-1H-pyrazol-3-carbonsaeure |
| 5-oxo-1-phenyl-2,5-dihydro-1H-pyrazole-3-carboxylic acid |
| 1-phenyl-3-carboxy-5-pyrazolone |
| 1-phenyl-5-pyrazolone-3-carboxylic acid |
| 1-phenyl-3-carboxypyrazol-5-one |
| 5-oxo-1-phenyl-2H-pyrazole-3-carboxylic Acid |