2-tert-butyl-6-[(dimethylamino)methyl]-4-methylphenol structure
|
Common Name | 2-tert-butyl-6-[(dimethylamino)methyl]-4-methylphenol | ||
|---|---|---|---|---|
| CAS Number | 4142-59-0 | Molecular Weight | 221.33900 | |
| Density | 0.973g/cm3 | Boiling Point | 275.9ºC at 760mmHg | |
| Molecular Formula | C14H23NO | Melting Point | 46-49ºC | |
| MSDS | N/A | Flash Point | 91ºC | |
| Name | 2-tert-butyl-6-[(dimethylamino)methyl]-4-methylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.973g/cm3 |
|---|---|
| Boiling Point | 275.9ºC at 760mmHg |
| Melting Point | 46-49ºC |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.33900 |
| Flash Point | 91ºC |
| Exact Mass | 221.17800 |
| PSA | 23.47000 |
| LogP | 3.05970 |
| Index of Refraction | 1.521 |
| InChIKey | GNZOGLOOGZLFHM-UHFFFAOYSA-N |
| SMILES | Cc1cc(CN(C)C)c(O)c(C(C)(C)C)c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2922299090 |
|
~85%
2-tert-butyl-6-... CAS#:4142-59-0 |
| Literature: Cazaux, Jean-Benoit; Braunstein, Pierre; Magna, Lionel; Saussine, Lucien; Olivier-Bourbigou, Helene European Journal of Inorganic Chemistry, 2009 , # 20 p. 2942 - 2950 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-tert-butyl-4-methyl-6-(N-dimethylaminomethyl)phenol |
| CA-0831 |
| 2-(TERT-BUTYL)-6-[(DIMETHYLAMINO)METHYL]-4-METHYLPHENOL |
| butyldimethylaminomethylmethylbenzenol |
| 2-tert-butyl-4-methyl-6-(dimethylaminomethyl)phenol |