Methylenebis(trichlorosilane) structure
|
Common Name | Methylenebis(trichlorosilane) | ||
|---|---|---|---|---|
| CAS Number | 4142-85-2 | Molecular Weight | 282.916 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 145.0±13.0 °C at 760 mmHg | |
| Molecular Formula | CH2Cl6Si2 | Melting Point | N/A | |
| MSDS | Chinese | Flash Point | 31.4±14.6 °C | |
| Symbol |
GHS02, GHS05 |
Signal Word | Danger | |
| Name | trichloro(trichlorosilylmethyl)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 145.0±13.0 °C at 760 mmHg |
| Molecular Formula | CH2Cl6Si2 |
| Molecular Weight | 282.916 |
| Flash Point | 31.4±14.6 °C |
| Exact Mass | 279.782623 |
| LogP | 8.31 |
| Vapour Pressure | 6.3±0.3 mmHg at 25°C |
| Index of Refraction | 1.488 |
| InChIKey | ABDDAHLAEXNYRC-UHFFFAOYSA-N |
| SMILES | Cl[Si](Cl)(Cl)C[Si](Cl)(Cl)Cl |
| Symbol |
GHS02, GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H261-H314 |
| Precautionary Statements | P231 + P232-P280-P305 + P351 + P338-P310-P422 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | C: Corrosive; |
| Risk Phrases | 14/15-34 |
| Safety Phrases | 26-36/37/39-43-45-7/8 |
| RIDADR | UN 3094 8/PG 2 |
| WGK Germany | 3 |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Methylenebis(trichlorosilane) |
| Silane,1,1'-methylenebis[1,1,1-trichloro |
| hexachlorodisilmethylene |
| 1,1,1,3,3,3-hexachloro-1,3-disilapropane |
| bis(trichlorosilyl)methane |
| bis-trichlorosilanyl-methane |
| hexa-Si-chloro-Si,Si'-methanediyl-bis-silane |
| Silane, 1,1'-methylenebis[1,1,1-trichloro- |
| di(trichlorosilyl)methane |
| MFCD00270969 |
| Bis-trichlorsilyl-methan |