2-methyl-1-phenyl-1-pyridin-2-yl-3-pyrrolidin-1-ylpropan-1-ol structure
|
Common Name | 2-methyl-1-phenyl-1-pyridin-2-yl-3-pyrrolidin-1-ylpropan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 4151-00-2 | Molecular Weight | 296.40700 | |
| Density | 1.113g/cm3 | Boiling Point | 471.4ºC at 760 mmHg | |
| Molecular Formula | C19H24N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.9ºC | |
| Name | 2-methyl-1-phenyl-1-pyridin-2-yl-3-pyrrolidin-1-ylpropan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.113g/cm3 |
|---|---|
| Boiling Point | 471.4ºC at 760 mmHg |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.40700 |
| Flash Point | 238.9ºC |
| Exact Mass | 296.18900 |
| PSA | 36.36000 |
| LogP | 2.98730 |
| Index of Refraction | 1.58 |
| InChIKey | VBTFCCSRDNNZLY-UHFFFAOYSA-N |
| SMILES | CC(CN1CCCC1)C(O)(c1ccccc1)c1ccccn1 |
| HS Code | 2933990090 |
|---|
|
~%
2-methyl-1-phen... CAS#:4151-00-2 |
| Literature: Adamson et al. Journal of the Chemical Society, 1958 , p. 312,315 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Methyl-1-phenyl-1-(pyridyl-2)-3-pyrrolidino-propan-1-ol |
| 2-methyl-1-phenyl-1-(pyridin-2-yl)-3-(pyrrolidin-1-yl)propan-1-ol |
| 2-methyl-1-phenyl-1-[2]pyridyl-3-pyrrolidino-propan-1-ol |