Rhamnocitrin 3-glucoside structure
|
Common Name | Rhamnocitrin 3-glucoside | ||
|---|---|---|---|---|
| CAS Number | 41545-37-3 | Molecular Weight | 462.40 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H22O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Rhamnocitrin 3-glucosideRhamnocitrin 3-glucoside (Rhamnocitrin-3-O-β-D-glucopyranoside) is a natural product that can be isolated from Astragalus membranaceus (Fisch.) Bge. var. mongholicus (Bge.) Hsiao (AM)[1]. |
| Name | 5,4'-dihydroxy-7-methoxyflavone 3-o-beta-d-glucopyranoside |
|---|
| Description | Rhamnocitrin 3-glucoside (Rhamnocitrin-3-O-β-D-glucopyranoside) is a natural product that can be isolated from Astragalus membranaceus (Fisch.) Bge. var. mongholicus (Bge.) Hsiao (AM)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C22H22O11 |
|---|---|
| Molecular Weight | 462.40 |
| InChIKey | ULVBHEFDGPIWAT-LFXZADKFSA-N |
| SMILES | COc1cc(O)c2c(=O)c(OC3OC(CO)C(O)C(O)C3O)c(-c3ccc(O)cc3)oc2c1 |