Poricoic acid G structure
|
Common Name | Poricoic acid G | ||
|---|---|---|---|---|
| CAS Number | 415724-84-4 | Molecular Weight | 486.68 | |
| Density | 1.12±0.1 g/cm3(Predicted) | Boiling Point | 637.6±55.0 °C(Predicted) | |
| Molecular Formula | C30H46O5 | Melting Point | 260 °C (decomp) | |
| MSDS | N/A | Flash Point | N/A | |
Use of Poricoic acid GPoricoic acid G is a triterpenoid that can be isolated from Poria cocos. Poricoic acid G has a significant cytotoxic effect on leukemia cells and is a potential potent anti-leukemic compound in humans[1]. |
| Name | Poricoic acid G |
|---|
| Description | Poricoic acid G is a triterpenoid that can be isolated from Poria cocos. Poricoic acid G has a significant cytotoxic effect on leukemia cells and is a potential potent anti-leukemic compound in humans[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.12±0.1 g/cm3(Predicted) |
|---|---|
| Boiling Point | 637.6±55.0 °C(Predicted) |
| Melting Point | 260 °C (decomp) |
| Molecular Formula | C30H46O5 |
| Molecular Weight | 486.68 |
| InChIKey | VPTZOSBKEDUOFE-KXGBKNTBSA-N |
| SMILES | C=C(C)C1CCC2=C(CCC3(C)C(C(CCC=C(C)C)C(=O)O)C(O)CC23C)C1(C)CCC(=O)O |