3-phenyl-3-propyl-pentanedioic acid
Modify Date: 2025-09-19 09:19:54
3-phenyl-3-propyl-pentanedioic acid structure
|
Common Name | 3-phenyl-3-propyl-pentanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 4160-94-5 | Molecular Weight | 250.29000 | |
| Density | 1.183g/cm3 | Boiling Point | 393.4ºC at 760 mmHg | |
| Molecular Formula | C14H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.9ºC | |
| Name | 3-phenyl-3-propylpentanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.183g/cm3 |
|---|---|
| Boiling Point | 393.4ºC at 760 mmHg |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29000 |
| Flash Point | 205.9ºC |
| Exact Mass | 250.12100 |
| PSA | 74.60000 |
| LogP | 2.67390 |
| Index of Refraction | 1.539 |
| InChIKey | VVYCAUXALDXXBS-UHFFFAOYSA-N |
| SMILES | CCCC(CC(=O)O)(CC(=O)O)c1ccccc1 |
| HS Code | 2917399090 |
|---|
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| EINECS 224-001-2 |
| 3-phenyl-3-propyl-glutaric acid |
| 3-Phenyl-3-propyl-glutarsaeure |
| 3-Propyl-3-phenyl-glutarsaeure |