3-Phenylpentanedioic acid structure
|
Common Name | 3-Phenylpentanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 4165-96-2 | Molecular Weight | 208.211 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 359.4±22.0 °C at 760 mmHg | |
| Molecular Formula | C11H12O4 | Melting Point | 140-143 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 185.3±18.8 °C | |
| Name | 3-Phenylglutaric acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 359.4±22.0 °C at 760 mmHg |
| Melting Point | 140-143 °C(lit.) |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.211 |
| Flash Point | 185.3±18.8 °C |
| Exact Mass | 208.073563 |
| PSA | 74.60000 |
| LogP | 0.57 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | RZOKZOYSUCSPDF-UHFFFAOYSA-N |
| SMILES | O=C(O)CC(CC(=O)O)c1ccccc1 |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| MFCD00002718 |
| 3-Phenylpentanedioic acid |
| EINECS 224-016-4 |
| Pentanedioic acid, 3-phenyl- |