1-(1-PIPERAZINYL)ADAMANTANEDIHYDROCHLORIDE structure
|
Common Name | 1-(1-PIPERAZINYL)ADAMANTANEDIHYDROCHLORIDE | ||
|---|---|---|---|---|
| CAS Number | 41717-26-4 | Molecular Weight | 218.33800 | |
| Density | 0.989g/cm3 | Boiling Point | 330.2ºC at 760 mmHg | |
| Molecular Formula | C14H22N2 | Melting Point | 88-98ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 128.5ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-[(2,4,6-trimethylphenyl)methyl]piperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.989g/cm3 |
|---|---|
| Boiling Point | 330.2ºC at 760 mmHg |
| Melting Point | 88-98ºC(lit.) |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.33800 |
| Flash Point | 128.5ºC |
| Exact Mass | 218.17800 |
| PSA | 15.27000 |
| LogP | 2.28370 |
| Index of Refraction | 1.537 |
| InChIKey | FOERNUXLFALRDN-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(CN2CCNCC2)c(C)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933599090 |
|
~93%
1-(1-PIPERAZINY... CAS#:41717-26-4 |
| Literature: Zhang, Cunlong; Tan, Chunyan; Zu, Xuyu; Zhai, Xin; Liu, Feng; Chu, Bizhu; Ma, Xiaohua; Chen, Yuzong; Gong, Ping; Jiang, Yuyang European Journal of Medicinal Chemistry, 2011 , vol. 46, # 4 p. 1404 - 1414 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| OR0077 |
| 2,4,6-trimethylbenzylpiperazine |