phenyl 2-hydroxy-3-methylbenzoate structure
|
Common Name | phenyl 2-hydroxy-3-methylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 41755-73-1 | Molecular Weight | 228.24300 | |
| Density | 1.216g/cm3 | Boiling Point | 348.9ºC at 760mmHg | |
| Molecular Formula | C14H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146.3ºC | |
| Name | phenyl 2-hydroxy-3-methylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.216g/cm3 |
|---|---|
| Boiling Point | 348.9ºC at 760mmHg |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.24300 |
| Flash Point | 146.3ºC |
| Exact Mass | 228.07900 |
| PSA | 46.53000 |
| LogP | 2.91980 |
| Index of Refraction | 1.605 |
| InChIKey | YEBPMWUBZDANBU-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C(=O)Oc2ccccc2)c1O |
| HS Code | 2918290000 |
|---|
|
~62%
phenyl 2-hydrox... CAS#:41755-73-1 |
| Literature: Petrlikova, Eva; Waisser, Karel; Palat Jr., Karel; Kunes, Jiri; Kaustova, Jarmila Chemical Papers, 2011 , vol. 65, # 1 p. 52 - 59 |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| EINECS 255-535-4 |
| 2-Hydroxy-3-methyl-benzoesaeure-phenylester |
| 2-hydroxy-3-methyl-benzoic acid phenyl ester |
| phenyl 3-methylsalicylate |
| o-Kresotinsaeure-phenylester |