2-tert-butyl-3,3-dimethylbutanoic acid
Modify Date: 2025-09-24 20:55:59
2-tert-butyl-3,3-dimethylbutanoic acid structure
|
Common Name | 2-tert-butyl-3,3-dimethylbutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 41785-81-3 | Molecular Weight | 172.26500 | |
| Density | 0.912g/cm3 | Boiling Point | 252.8ºC at 760mmHg | |
| Molecular Formula | C10H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 111.4ºC | |
| Name | 2-tert-butyl-3,3-dimethylbutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 0.912g/cm3 |
|---|---|
| Boiling Point | 252.8ºC at 760mmHg |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.26500 |
| Flash Point | 111.4ºC |
| Exact Mass | 172.14600 |
| PSA | 37.30000 |
| LogP | 2.77940 |
| Index of Refraction | 1.441 |
| InChIKey | CSUSKPNFQZZRGX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C(=O)O)C(C)(C)C |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| di-tert-butylacetic acid |
| Di-tert.-butyl-essigsaeure |
| 2-t-butyl-3,3-dimethylbutanoic acid |
| 2-tert-butyl-3,3-dimethyl-butyric acid |
| tBu2CH-COOH |