mercusicacid structure
|
Common Name | mercusicacid | ||
|---|---|---|---|---|
| CAS Number | 41787-69-3 | Molecular Weight | 336.466 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 486.7±38.0 °C at 760 mmHg | |
| Molecular Formula | C20H32O4 | Melting Point | 122-128℃ | |
| MSDS | N/A | Flash Point | 262.2±23.3 °C | |
| Name | junicedric acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 486.7±38.0 °C at 760 mmHg |
| Melting Point | 122-128℃ |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.466 |
| Flash Point | 262.2±23.3 °C |
| Exact Mass | 336.230072 |
| PSA | 74.60000 |
| LogP | 5.37 |
| Vapour Pressure | 0.0±2.6 mmHg at 25°C |
| Index of Refraction | 1.521 |
| InChIKey | HPQKNJHVWUWAOR-XCFCUDCHSA-N |
| SMILES | C=C1CCC2C(C)(C(=O)O)CCCC2(C)C1CCC(C)CC(=O)O |
| Hazard Codes | Xi |
|---|
|
Name: Inhibition of human recombinant PTP-1B using IR5 insulin receptor residues as substra...
Source: ChEMBL
Target: Tyrosine-protein phosphatase non-receptor type 1
External Id: CHEMBL3782748
|
| (1S,4aR,5S,8aR)-5-[(3S)-4-Carboxy-3-methylbutyl]-1,4a-dimethyl-6-methylenedecahydro-1-naphthalenecarboxylic acid |
| Junicedric acid |
| (βS,1S,4aR,5S,8aR)-5-carboxy-decahydro-β,5,8a-trimethyl-2-methylenenaphthalene-1-pentanoic acid |
| (13S)-dihydroagathic acid |
| enantio-oliveric acid |