Benzenemethanamine,N-[(4-chlorophenyl)methylene]-a-methyl-, (aS)- structure
|
Common Name | Benzenemethanamine,N-[(4-chlorophenyl)methylene]-a-methyl-, (aS)- | ||
|---|---|---|---|---|
| CAS Number | 4187-48-8 | Molecular Weight | 243.73100 | |
| Density | 1.05g/cm3 | Boiling Point | 341.3ºC at 760 mmHg | |
| Molecular Formula | C15H14ClN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.2ºC | |
| Name | 1-(4-chlorophenyl)-N-(1-phenylethyl)methanimine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.05g/cm3 |
|---|---|
| Boiling Point | 341.3ºC at 760 mmHg |
| Molecular Formula | C15H14ClN |
| Molecular Weight | 243.73100 |
| Flash Point | 160.2ºC |
| Exact Mass | 243.08100 |
| PSA | 12.36000 |
| LogP | 4.52010 |
| Index of Refraction | 1.556 |
| InChIKey | BMKJZUDJOBZDLG-UHFFFAOYSA-N |
| SMILES | CC(N=Cc1ccc(Cl)cc1)c1ccccc1 |
|
~97%
Benzenemethanam... CAS#:4187-48-8 |
| Literature: Mayani, Vishal J.; Abdi, Sayed H. R.; Kureshy, Rukhsana I.; Khan, Noor-Ul H.; Das, Anjan; Bajaj, Hari C. Journal of Organic Chemistry, 2010 , vol. 75, # 18 p. 6191 - 6195 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (4-chloro-benzylidene)-((S)-1-phenyl-ethyl)-amine |
| (4-Chlor-benzyliden)-((S)-1-phenyl-aethyl)-amin |
| 1-(4-chlorophenyl)-N-[(1S)-1-phenylethyl]methanimine |
| n-[(e)-(4-chlorophenyl)methylidene]-1-phenylethanamine |
| (S)-N-(4-chlorobenzylidene)-1-phenylethanamine |
| 4-Clor-benzaldehyd-((S)-1-phenyl-aethylimin) |