Benzamide,N-(2-oxo-2-phenylethyl)- structure
|
Common Name | Benzamide,N-(2-oxo-2-phenylethyl)- | ||
|---|---|---|---|---|
| CAS Number | 4190-14-1 | Molecular Weight | 239.26900 | |
| Density | 1.163g/cm3 | Boiling Point | 478.9ºC at 760mmHg | |
| Molecular Formula | C15H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.2ºC | |
| Name | N-phenacylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.163g/cm3 |
|---|---|
| Boiling Point | 478.9ºC at 760mmHg |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.26900 |
| Flash Point | 197.2ºC |
| Exact Mass | 239.09500 |
| PSA | 46.17000 |
| LogP | 2.69020 |
| Index of Refraction | 1.59 |
| InChIKey | MIJZKZQWQXKSPA-UHFFFAOYSA-N |
| SMILES | O=C(CNC(=O)c1ccccc1)c1ccccc1 |
| HS Code | 2924299090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-benzoylamino-1-phenylethanone |
| muricatisine |
| Benzamide,N-phenacyl |
| N-benzoyl-2-oxo-2-phenylethylamine |
| BENZAMIDO ACETOPHENONE |
| N-(2-oxo-2-phenyl-ethyl)benzamide |