5-[amino(methyl)amino]-4-chloro-2-(4-methylphenyl)pyridazin-3-one structure
|
Common Name | 5-[amino(methyl)amino]-4-chloro-2-(4-methylphenyl)pyridazin-3-one | ||
|---|---|---|---|---|
| CAS Number | 41933-01-1 | Molecular Weight | 264.71100 | |
| Density | 1.34g/cm3 | Boiling Point | 381.9ºC at 760 mmHg | |
| Molecular Formula | C12H13ClN4O | Melting Point | 136ºC | |
| MSDS | N/A | Flash Point | 184.7ºC | |
| Name | 5-[amino(methyl)amino]-4-chloro-2-(4-methylphenyl)pyridazin-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 381.9ºC at 760 mmHg |
| Melting Point | 136ºC |
| Molecular Formula | C12H13ClN4O |
| Molecular Weight | 264.71100 |
| Flash Point | 184.7ºC |
| Exact Mass | 264.07800 |
| PSA | 64.15000 |
| LogP | 2.20450 |
| Index of Refraction | 1.638 |
| InChIKey | BAWNUIKKPHPLGU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-n2ncc(N(C)N)c(Cl)c2=O)cc1 |
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-chloro-5-(N-methyl-hydrazino)-2-p-tolyl-2H-pyridazin-3-one |
| 4-chloro-2-(p-tolyl)-5-(1-methylhydrazino)-pyridazin-3(2H)-one |
| 4-chloro-5-(1-methylhydrazino)-2-(4-methylphenyl)-2,3-dihydropyridazin-3-one |