asischem d51176 structure
|
Common Name | asischem d51176 | ||
|---|---|---|---|---|
| CAS Number | 419540-45-7 | Molecular Weight | 207.25200 | |
| Density | 1.328g/cm3 | Boiling Point | 424.903ºC at 760 mmHg | |
| Molecular Formula | C9H9N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.774ºC | |
| Name | 5-(3-Methoxyphenyl)-2,4-dihydro-3H-1,2,4-triazole-3-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.328g/cm3 |
|---|---|
| Boiling Point | 424.903ºC at 760 mmHg |
| Molecular Formula | C9H9N3OS |
| Molecular Weight | 207.25200 |
| Flash Point | 210.774ºC |
| Exact Mass | 207.04700 |
| PSA | 89.60000 |
| LogP | 1.76900 |
| Index of Refraction | 1.641 |
| InChIKey | RTTMZCCBDAJGRW-UHFFFAOYSA-N |
| SMILES | COc1cccc(-c2nc(=S)[nH][nH]2)c1 |
|
~71%
asischem d51176 CAS#:419540-45-7 |
| Literature: Labanauskas; Udrenaite; Gaidelis; Brukstus Farmaco, 2004 , vol. 59, # 4 p. 255 - 259 |
|
~%
asischem d51176 CAS#:419540-45-7 |
| Literature: Labanauskas; Udrenaite; Gaidelis; Brukstus Farmaco, 2004 , vol. 59, # 4 p. 255 - 259 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-(3-methoxyphenyl)-1,2-dihydro-1,2,4-triazole-3-thione |