Phosphinousamide, N-(1,1-dimethylethyl)-P,P-diphenyl- structure
|
Common Name | Phosphinousamide, N-(1,1-dimethylethyl)-P,P-diphenyl- | ||
|---|---|---|---|---|
| CAS Number | 41979-47-9 | Molecular Weight | 257.31000 | |
| Density | N/A | Boiling Point | 352.3ºC at 760mmHg | |
| Molecular Formula | C16H20NP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.8ºC | |
| Name | N-diphenylphosphanyl-2-methylpropan-2-amine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 352.3ºC at 760mmHg |
|---|---|
| Molecular Formula | C16H20NP |
| Molecular Weight | 257.31000 |
| Flash Point | 166.8ºC |
| Exact Mass | 257.13300 |
| PSA | 25.62000 |
| LogP | 3.81330 |
| InChIKey | SYLDOBJLWJSZBQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NP(c1ccccc1)c1ccccc1 |
|
~%
Phosphinousamid... CAS#:41979-47-9 |
| Literature: Brueck, A.; Kuchen, W.; Peters, W. Phosphorus, Sulfur and Silicon and the Related Elements, 1995 , vol. 107, # 1-4 p. 129 - 134 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| tert.-Butylamino-diphenyl-phosphin |
| N-diphenylphosphino-tert.-butylamine |
| n-tert-butyl-p,p-diphenylphosphinous amide |
| N-tert.-Butylamino-diphenyl-phosphin |
| diphenylphosphino-t-butylamine |