Dihydropashanone structure
|
Common Name | Dihydropashanone | ||
|---|---|---|---|---|
| CAS Number | 41997-41-5 | Molecular Weight | 302.322 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 499.2±45.0 °C at 760 mmHg | |
| Molecular Formula | C17H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.9±22.2 °C | |
| Name | 1-(2,6-dihydroxy-3,4-dimethoxyphenyl)-3-phenylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 499.2±45.0 °C at 760 mmHg |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.322 |
| Flash Point | 182.9±22.2 °C |
| Exact Mass | 302.115417 |
| PSA | 75.99000 |
| LogP | 4.54 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | JIPRVIMCAIKNJN-UHFFFAOYSA-N |
| SMILES | COc1cc(O)c(C(=O)CCc2ccccc2)c(O)c1OC |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914509090 |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1-Propanone, 1-(2,6-dihydroxy-3,4-dimethoxyphenyl)-3-phenyl- |
| Dihydropashanone |
| 2',6'-dihydroxy-3',4'-dimethoxydihydrochalcone |
| 1-(2,6-Dihydroxy-3,4-dimethoxyphenyl)-3-phenyl-1-propanone |
| 1-(2,6-Dihydroxy-3,4-dimethoxyphenyl)-3-phenylpropan-1-one |