Dihydropashanone
Dihydropashanone structure
|
Common Name | Dihydropashanone | ||
|---|---|---|---|---|
| CAS Number | 41997-41-5 | Molecular Weight | 302.322 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 499.2±45.0 °C at 760 mmHg | |
| Molecular Formula | C17H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.9±22.2 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(2,6-dihydroxy-3,4-dimethoxyphenyl)-3-phenylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 499.2±45.0 °C at 760 mmHg |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.322 |
| Flash Point | 182.9±22.2 °C |
| Exact Mass | 302.115417 |
| PSA | 75.99000 |
| LogP | 4.54 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | JIPRVIMCAIKNJN-UHFFFAOYSA-N |
| SMILES | COc1cc(O)c(C(=O)CCc2ccccc2)c(O)c1OC |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914509090 |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Dihydropashanone |
| 2',6'-dihydroxy-3',4'-dimethoxydihydrochalcone |
| 1-(2,6-Dihydroxy-3,4-dimethoxyphenyl)-3-phenyl-1-propanone |
| 1-(2,6-Dihydroxy-3,4-dimethoxyphenyl)-3-phenylpropan-1-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-(2,6-dihydroxy-3,4-dimethoxyphenyl)-3-phenylpropan-1-one? |
| A: SMILES notation of 1-(2,6-dihydroxy-3,4-dimethoxyphenyl)-3-phenylpropan-1-one is COc1cc(O)c(C(=O)CCc2ccccc2)c(O)c1OC. |
| Q: What is the molecular formula of 1-(2,6-dihydroxy-3,4-dimethoxyphenyl)-3-phenylpropan-1-one? |
| A: Molecular formula of 1-(2,6-dihydroxy-3,4-dimethoxyphenyl)-3-phenylpropan-1-one is C17H18O5. |
| Q: What is the InChIKey of 1-(2,6-dihydroxy-3,4-dimethoxyphenyl)-3-phenylpropan-1-one? |
| A: InChIKey of 1-(2,6-dihydroxy-3,4-dimethoxyphenyl)-3-phenylpropan-1-one is JIPRVIMCAIKNJN-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1-(2,6-dihydroxy-3,4-dimethoxyphenyl)-3-phenylpropan-1-one? |
| A: CAS number of 1-(2,6-dihydroxy-3,4-dimethoxyphenyl)-3-phenylpropan-1-one is 41997-41-5. |
| Q: What is the boiling point of 1-(2,6-dihydroxy-3,4-dimethoxyphenyl)-3-phenylpropan-1-one? |
| A: Boiling point of 1-(2,6-dihydroxy-3,4-dimethoxyphenyl)-3-phenylpropan-1-one is 499.2±45.0 °C at 760 mmHg. |
| Q: What is the LogP of 1-(2,6-dihydroxy-3,4-dimethoxyphenyl)-3-phenylpropan-1-one? |
| A: LogP of 1-(2,6-dihydroxy-3,4-dimethoxyphenyl)-3-phenylpropan-1-one is 4.54. |
| Q: What is the molecular weight of 1-(2,6-dihydroxy-3,4-dimethoxyphenyl)-3-phenylpropan-1-one? |
| A: Molecular weight of 1-(2,6-dihydroxy-3,4-dimethoxyphenyl)-3-phenylpropan-1-one is 302.322. |
| Q: What is the polar surface area (PSA) of 1-(2,6-dihydroxy-3,4-dimethoxyphenyl)-3-phenylpropan-1-one? |
| A: Polar surface area (PSA) of 1-(2,6-dihydroxy-3,4-dimethoxyphenyl)-3-phenylpropan-1-one is 75.99000. |
| Q: What English synonyms does 1-(2,6-dihydroxy-3,4-dimethoxyphenyl)-3-phenylpropan-1-one have? |
| A: English synonyms of 1-(2,6-dihydroxy-3,4-dimethoxyphenyl)-3-phenylpropan-1-one: Dihydropashanone, 2',6'-dihydroxy-3',4'-dimethoxydihydrochalcone, 1-(2,6-Dihydroxy-3,4-dimethoxyphenyl)-3-phenyl-1-propanone, 1-(2,6-Dihydroxy-3,4-dimethoxyphenyl)-3-phenylpropan-1-one. |
| Q: What is the English name of 1-(2,6-dihydroxy-3,4-dimethoxyphenyl)-3-phenylpropan-1-one? |
| A: The English name of 1-(2,6-dihydroxy-3,4-dimethoxyphenyl)-3-phenylpropan-1-one is 1-(2,6-dihydroxy-3,4-dimethoxyphenyl)-3-phenylpropan-1-one. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| BioBioPha |