1-(4-methoxynaphthalen-1-yl)sulfonyl-4-phenylpiperazine
1-(4-methoxynaphthalen-1-yl)sulfonyl-4-phenylpiperazine structure
|
Common Name | 1-(4-methoxynaphthalen-1-yl)sulfonyl-4-phenylpiperazine | ||
|---|---|---|---|---|
| CAS Number | 4200-62-8 | Molecular Weight | 382.47600 | |
| Density | 1.282g/cm3 | Boiling Point | 582ºC at 760 mmHg | |
| Molecular Formula | C21H22N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 305.8ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(4-methoxynaphthalen-1-yl)sulfonyl-4-phenylpiperazine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.282g/cm3 |
|---|---|
| Boiling Point | 582ºC at 760 mmHg |
| Molecular Formula | C21H22N2O3S |
| Molecular Weight | 382.47600 |
| Flash Point | 305.8ºC |
| Exact Mass | 382.13500 |
| PSA | 58.23000 |
| LogP | 4.44300 |
| Index of Refraction | 1.647 |
| InChIKey | GTYXJCDSPCBIOI-UHFFFAOYSA-N |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(c3ccccc3)CC2)c2ccccc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1-(4-methoxynap... CAS#:4200-62-8 |
| Literature: Escales; Baumann Chemische Berichte, 1886 , vol. 19, p. 1789 |
|
~%
1-(4-methoxynap... CAS#:4200-62-8 |
| Literature: Posner Chemische Berichte, 1901 , vol. 34, p. 2658 |
|
~%
1-(4-methoxynap... CAS#:4200-62-8 |
| Literature: Escales; Baumann Chemische Berichte, 1886 , vol. 19, p. 1789 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 2 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4,4-bis-phenylsulfanyl-valeric acid |
| 4,4-Bis-phenylmercapto-valeriansaeure |
| Laevulinsaeure-diphenylmercaptol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 1-(4-methoxynaphthalen-1-yl)sulfonyl-4-phenylpiperazine? |
| A: LogP of 1-(4-methoxynaphthalen-1-yl)sulfonyl-4-phenylpiperazine is 4.44300. |
| Q: What is the polar surface area (PSA) of 1-(4-methoxynaphthalen-1-yl)sulfonyl-4-phenylpiperazine? |
| A: Polar surface area (PSA) of 1-(4-methoxynaphthalen-1-yl)sulfonyl-4-phenylpiperazine is 58.23000. |
| Q: What is the boiling point of 1-(4-methoxynaphthalen-1-yl)sulfonyl-4-phenylpiperazine? |
| A: Boiling point of 1-(4-methoxynaphthalen-1-yl)sulfonyl-4-phenylpiperazine is 582ºC at 760 mmHg. |
| Q: What is the SMILES notation of 1-(4-methoxynaphthalen-1-yl)sulfonyl-4-phenylpiperazine? |
| A: SMILES notation of 1-(4-methoxynaphthalen-1-yl)sulfonyl-4-phenylpiperazine is COc1ccc(S(=O)(=O)N2CCN(c3ccccc3)CC2)c2ccccc12. |
| Q: What are the upstream materials of 1-(4-methoxynaphthalen-1-yl)sulfonyl-4-phenylpiperazine? |
| A: Related upstream materials(CAS) of 1-(4-methoxynaphthalen-1-yl)sulfonyl-4-phenylpiperazine: 108-98-5;123-76-2;64206-13-9;7647-01-0. |
| Q: What is the English name of 1-(4-methoxynaphthalen-1-yl)sulfonyl-4-phenylpiperazine? |
| A: The English name of 1-(4-methoxynaphthalen-1-yl)sulfonyl-4-phenylpiperazine is 1-(4-methoxynaphthalen-1-yl)sulfonyl-4-phenylpiperazine. |
| Q: What English synonyms does 1-(4-methoxynaphthalen-1-yl)sulfonyl-4-phenylpiperazine have? |
| A: English synonyms of 1-(4-methoxynaphthalen-1-yl)sulfonyl-4-phenylpiperazine: 4,4-bis-phenylsulfanyl-valeric acid, 4,4-Bis-phenylmercapto-valeriansaeure, Laevulinsaeure-diphenylmercaptol. |
| Q: What is the InChIKey of 1-(4-methoxynaphthalen-1-yl)sulfonyl-4-phenylpiperazine? |
| A: InChIKey of 1-(4-methoxynaphthalen-1-yl)sulfonyl-4-phenylpiperazine is GTYXJCDSPCBIOI-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 4200-62-8? |
| A: Chinese name of 4200-62-8 is 4200-62-8. |
| Q: What is the molecular weight of 1-(4-methoxynaphthalen-1-yl)sulfonyl-4-phenylpiperazine? |
| A: Molecular weight of 1-(4-methoxynaphthalen-1-yl)sulfonyl-4-phenylpiperazine is 382.47600. |