Cyclopentanone,2,5-bis[(4-nitrophenyl)methylene]- structure
|
Common Name | Cyclopentanone,2,5-bis[(4-nitrophenyl)methylene]- | ||
|---|---|---|---|---|
| CAS Number | 42019-85-2 | Molecular Weight | 350.32500 | |
| Density | 1.433g/cm3 | Boiling Point | 554ºC at 760mmHg | |
| Molecular Formula | C19H14N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.1ºC | |
| Name | 2,5-bis[(4-nitrophenyl)methylidene]cyclopentan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.433g/cm3 |
|---|---|
| Boiling Point | 554ºC at 760mmHg |
| Molecular Formula | C19H14N2O5 |
| Molecular Weight | 350.32500 |
| Flash Point | 265.1ºC |
| Exact Mass | 350.09000 |
| PSA | 108.71000 |
| LogP | 5.37930 |
| Index of Refraction | 1.729 |
| InChIKey | WRYUFOKEOTWUFL-JOBJLJCHSA-N |
| SMILES | O=C1C(=Cc2ccc([N+](=O)[O-])cc2)CCC1=Cc1ccc([N+](=O)[O-])cc1 |
|
~96%
Cyclopentanone,... CAS#:42019-85-2 |
| Literature: Amoozadeh, Ali; Rahmani, Salman; Nemati, Firouzeh South African Journal of Chemistry, 2010 , vol. 63, p. 72 - 74 |
|
~%
Cyclopentanone,... CAS#:42019-85-2 |
| Literature: Hellmann,H.; Dieterich,D. Justus Liebigs Annalen der Chemie, 1962 , vol. 656, p. 89 - 96 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2,5-Bis-(4-nitro-benzyliden)-cyclopentanon |
| 2,5-Bis-(4-nitro-benzyliden)-cyclopentanon-(1) |
| 2,5-bis-(4-nitro-benzylidene)-cyclopentanone |
| 2,5-di(p-nitrobenzylidene)cyclopentanone |
| 1.3-Bis-(4-nitro-benzal)-cyclopentanon-(2) |
| Pyrimidine,2,5-bis(4-hexylphenyl) |
| 2,5-bis-(4-hexyl-phenyl)-pyrimidine |
| 2,5-Bis-(4-n-hexylphenyl)pyrimidin |