5-Nitro-2-(4-chlorophenylthio)benzaldehyde
Modify Date: 2025-09-06 20:23:13
5-Nitro-2-(4-chlorophenylthio)benzaldehyde structure
|
Common Name | 5-Nitro-2-(4-chlorophenylthio)benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 42191-01-5 | Molecular Weight | 293.72600 | |
| Density | 1.46g/cm3 | Boiling Point | 451.5ºC at 760mmHg | |
| Molecular Formula | C13H8ClNO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.8ºC | |
| Name | 2-(4-chlorophenyl)sulfanyl-5-nitrobenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 451.5ºC at 760mmHg |
| Molecular Formula | C13H8ClNO3S |
| Molecular Weight | 293.72600 |
| Flash Point | 226.8ºC |
| Exact Mass | 292.99100 |
| PSA | 88.19000 |
| LogP | 4.73510 |
| Index of Refraction | 1.675 |
| InChIKey | TVVNZBSLUREFJN-UHFFFAOYSA-N |
| SMILES | O=Cc1cc([N+](=O)[O-])ccc1Sc1ccc(Cl)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2930909090 |
|
~%
5-Nitro-2-(4-ch... CAS#:42191-01-5 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 5, # 12 p. 2203 - 2211 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-[(4-chlorophenyl)sulfanyl]-5-nitrobenzaldehyde |
| JS-005C |