heptafluoro-n-propyl bromide
heptafluoro-n-propyl bromide structure
|
Common Name | heptafluoro-n-propyl bromide | ||
|---|---|---|---|---|
| CAS Number | 422-85-5 | Molecular Weight | 248.92500 | |
| Density | 1,875 g/cm3 | Boiling Point | 12°C | |
| Molecular Formula | C3BrF7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 1-Bromo-1,1,2,2,3,3,3-heptafluoropropane (CAS号：422-85-5), molecular formula C3BrF7, molecular weight 248.92500. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-bromo-1,1,2,2,3,3,3-heptafluoropropane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1,875 g/cm3 |
|---|---|
| Boiling Point | 12°C |
| Molecular Formula | C3BrF7 |
| Molecular Weight | 248.92500 |
| Exact Mass | 247.90700 |
| LogP | 3.17170 |
| Vapour Pressure | 1020mmHg at 25°C |
| Index of Refraction | 1.307 |
| InChIKey | LANNRYWUUQMNPF-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)Br |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | S23-S36 |
| RIDADR | 3163 |
| HS Code | 2903799090 |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2903799090 |
|---|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-bromo-1,1,2,2,3,3,3-heptafluoro-propane |
| 1,1,2,2,3,3,3-Heptafluor-1-brom-propan |
| 1-bromo-heptafluoro-propane |
| Perfluoropropyl Bromide |
| Heptafluoropropyl bromide |
| MFCD00039238 |
| F-n-Propyl bromide |
| 1-Brom-heptafluor-propan |
| perfluoro-n-propyl bromide |
| EINECS 207-023-7 |
| Heptafluoro-n-propyl bromide |
| 1-Bromoperfluoropropane |
| n-Heptafluoropropyl bromide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 1-bromo-1,1,2,2,3,3,3-heptafluoropropane? |
| A: LogP of 1-bromo-1,1,2,2,3,3,3-heptafluoropropane is 3.17170. |
| Q: What is the molecular weight of 1-bromo-1,1,2,2,3,3,3-heptafluoropropane? |
| A: Molecular weight of 1-bromo-1,1,2,2,3,3,3-heptafluoropropane is 248.92500. |
| Q: What is the English name of 1-bromo-1,1,2,2,3,3,3-heptafluoropropane? |
| A: The English name of 1-bromo-1,1,2,2,3,3,3-heptafluoropropane is 1-bromo-1,1,2,2,3,3,3-heptafluoropropane. |
| Q: What is the molecular formula of 1-bromo-1,1,2,2,3,3,3-heptafluoropropane? |
| A: Molecular formula of 1-bromo-1,1,2,2,3,3,3-heptafluoropropane is C3BrF7. |
| Q: What is the CAS number of 1-bromo-1,1,2,2,3,3,3-heptafluoropropane? |
| A: CAS number of 1-bromo-1,1,2,2,3,3,3-heptafluoropropane is 422-85-5. |
| Q: What is the safety information for 1-bromo-1,1,2,2,3,3,3-heptafluoropropane? |
| A: Safety information for 1-bromo-1,1,2,2,3,3,3-heptafluoropropane: S23-S36. |
| Q: What English synonyms does 1-bromo-1,1,2,2,3,3,3-heptafluoropropane have? |
| A: English synonyms of 1-bromo-1,1,2,2,3,3,3-heptafluoropropane: 1-bromo-1,1,2,2,3,3,3-heptafluoro-propane, 1,1,2,2,3,3,3-Heptafluor-1-brom-propan, 1-bromo-heptafluoro-propane, Perfluoropropyl Bromide, Heptafluoropropyl bromide, MFCD00039238, F-n-Propyl bromide, 1-Brom-heptafluor-propan, perfluoro-n-propyl bromide, EINECS 207-023-7, Heptafluoro-n-propyl bromide, 1-Bromoperfluoropropane, n-Heptafluoropropyl bromide. |
| Q: What is the InChIKey of 1-bromo-1,1,2,2,3,3,3-heptafluoropropane? |
| A: InChIKey of 1-bromo-1,1,2,2,3,3,3-heptafluoropropane is LANNRYWUUQMNPF-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1-bromo-1,1,2,2,3,3,3-heptafluoropropane? |
| A: SMILES notation of 1-bromo-1,1,2,2,3,3,3-heptafluoropropane is FC(F)(F)C(F)(F)C(F)(F)Br. |
| Q: What is the boiling point of 1-bromo-1,1,2,2,3,3,3-heptafluoropropane? |
| A: Boiling point of 1-bromo-1,1,2,2,3,3,3-heptafluoropropane is 12°C. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |