phenyl 3,5-ditert-butyl-4-hydroxybenzoate structure
|
Common Name | phenyl 3,5-ditert-butyl-4-hydroxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 4221-74-3 | Molecular Weight | 326.42900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H26O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | phenyl 3,5-ditert-butyl-4-hydroxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H26O3 |
|---|---|
| Molecular Weight | 326.42900 |
| Exact Mass | 326.18800 |
| PSA | 46.53000 |
| LogP | 5.20640 |
| InChIKey | YUIFFNHNYKNVNQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(C(=O)Oc2ccccc2)cc(C(C)(C)C)c1O |
| HS Code | 2918290000 |
|---|
|
~%
phenyl 3,5-dite... CAS#:4221-74-3 |
| Literature: Mueller,E. et al. Justus Liebigs Annalen der Chemie, 1961 , vol. 645, p. 36 - 52 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| 4-Hydroxy-3.5-di-tert-butyl-benzoesaeure-phenylester |
| Phenyl-3.5-di-tert-butyl-4-hydroxy-benzoat |