UV ABSORBER-120 structure
|
Common Name | UV ABSORBER-120 | ||
|---|---|---|---|---|
| CAS Number | 4221-80-1 | Molecular Weight | 438.64200 | |
| Density | 1.001 g/cm3 | Boiling Point | 521.3ºC at 760 mmHg | |
| Molecular Formula | C29H42O3 | Melting Point | 195-197°C | |
| MSDS | N/A | Flash Point | 191.3ºC | |
| Name | 2,4-Di-tert-butylphenyl 3,5-di-tert-butyl-4-hydroxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.001 g/cm3 |
|---|---|
| Boiling Point | 521.3ºC at 760 mmHg |
| Melting Point | 195-197°C |
| Molecular Formula | C29H42O3 |
| Molecular Weight | 438.64200 |
| Flash Point | 191.3ºC |
| Exact Mass | 438.31300 |
| PSA | 46.53000 |
| LogP | 7.80140 |
| Index of Refraction | 1.52 |
| InChIKey | KJYSXRBJOSZLEL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(OC(=O)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c(C(C)(C)C)c1 |
| Safety Phrases | S23-S24/25 |
|---|---|
| WGK Germany | 3 |
| HS Code | 2918290000 |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| 2',4'-di-t.-butylphenyl 3,5-di-t.-butyl-4-hydroxybenzoate |
| Tinuvin 120 |
| EINECS 224-166-0 |
| Sumisorb 400 |
| UVA-3 |
| 2,4-di-tert-butylphenyl-3,5-dibutyl-4-hydroxybenzoate |
| 3,5-di-tert-butyl-4-hydroxybenzoic acid 2,4-di-tert-butyl-phenyl ester |
| MFCD01076613 |
| UV ABSORBER-120 |
| DI-TERT-BUTYLPHENYL-3,5-DI-TERT-BUTYL-4-HYDROXYBENZOATE |
| 2,4-TERT-BUTYLPHENYL-3,5-DI-TERT-BUTYL-4-HYDROXYBENZOATE |
| 2,4-di-tert-butyl-phenyl 3,5-di-tert-butyl-4-hydroxy-benzoate |
| 3,5-Di |
| UV-120 |