bis(4-ethenylphenyl)diazene structure
|
Common Name | bis(4-ethenylphenyl)diazene | ||
|---|---|---|---|---|
| CAS Number | 42254-91-1 | Molecular Weight | 234.29600 | |
| Density | 0.97g/cm3 | Boiling Point | 397.9ºC at 760 mmHg | |
| Molecular Formula | C16H14N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.9ºC | |
| Name | bis(4-ethenylphenyl)diazene |
|---|---|
| Synonym | More Synonyms |
| Density | 0.97g/cm3 |
|---|---|
| Boiling Point | 397.9ºC at 760 mmHg |
| Molecular Formula | C16H14N2 |
| Molecular Weight | 234.29600 |
| Flash Point | 186.9ºC |
| Exact Mass | 234.11600 |
| PSA | 24.72000 |
| LogP | 5.38800 |
| Index of Refraction | 1.551 |
| InChIKey | AWKDEEXFAVIGAF-UHFFFAOYSA-N |
| SMILES | C=Cc1ccc(N=Nc2ccc(C=C)cc2)cc1 |
|
~%
bis(4-ethenylph... CAS#:42254-91-1 |
| Literature: Shine,H.J.; Chamness,J.T. Journal of Organic Chemistry, 1963 , vol. 28, p. 1232 - 1236 |
|
~%
bis(4-ethenylph... CAS#:42254-91-1 |
| Literature: Ohe, Kouichi; Uemura, Sakae; Sugita, Nobuyuki; Masuda, Hideki; Taga, Toru Journal of Organic Chemistry, 1989 , vol. 54, # 17 p. 4169 - 4174 |
| 4.4'-Divinyl-azobenzol |
| divinyl azobenzene |
| 4,4'-divinylazobenzene |