8-methyl-4-phenyl-2,3,5,8,10-pentazabicyclo[4.4.0]deca-2,4,11-triene-7,9-dione structure
|
Common Name | 8-methyl-4-phenyl-2,3,5,8,10-pentazabicyclo[4.4.0]deca-2,4,11-triene-7,9-dione | ||
|---|---|---|---|---|
| CAS Number | 42285-76-7 | Molecular Weight | 255.23200 | |
| Density | 1.407g/cm3 | Boiling Point | 381.4ºC at 760mmHg | |
| Molecular Formula | C12H9N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.4ºC | |
| Name | 6-methyl-3-phenyl-8H-pyrimido[5,4-e][1,2,4]triazine-5,7-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.407g/cm3 |
|---|---|
| Boiling Point | 381.4ºC at 760mmHg |
| Molecular Formula | C12H9N5O2 |
| Molecular Weight | 255.23200 |
| Flash Point | 184.4ºC |
| Exact Mass | 255.07600 |
| PSA | 93.53000 |
| LogP | 0.07880 |
| InChIKey | NVBYFWGBTBIMQL-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)[nH]c2nnc(-c3ccccc3)nc2c1=O |
| Precursor 5 | |
|---|---|
| DownStream 4 | |
|
Name: Intrinsic clearance in mouse liver microsomes assessed per mg protein at 1 uM measure...
Source: ChEMBL
Target: N/A
External Id: CHEMBL4610607
|
|
Name: Permeability across apical to basolateral side in MDCK2-MDR1 cells at 10 uM incubated...
Source: ChEMBL
Target: N/A
External Id: CHEMBL4610606
|
|
Name: Efflux ratio of permeability from basolateral to apical over apical to basolateral si...
Source: ChEMBL
Target: N/A
External Id: CHEMBL4610608
|
|
Name: Substrate activity at P-gp in MDCK2-MDR1 cells at 10 uM incubated for 60 mins in pres...
Source: ChEMBL
Target: N/A
External Id: CHEMBL4610602
|
| 1-Demethyl-3-phenyl-toxoflavin |
| 3-Phenylreumycin |
| 3-Methyl-6-phenyl-7-azalumazine |
| 3-Phenyl-1-demethyltoxoflavin |
| 6-Methyl-3-phenylpyrimido[5,4-e][1,2,4]triazine-5,7(6H,8H)-dione |