10-ethyl-8-methyl-4-phenyl-2,3,5,8,10-pentazabicyclo[4.4.0]deca-2,4,11-triene-7,9-dione structure
|
Common Name | 10-ethyl-8-methyl-4-phenyl-2,3,5,8,10-pentazabicyclo[4.4.0]deca-2,4,11-triene-7,9-dione | ||
|---|---|---|---|---|
| CAS Number | 42285-85-8 | Molecular Weight | 283.28500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-ethyl-6-methyl-3-phenylpyrimido[5,4-e][1,2,4]triazine-5,7-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H13N5O2 |
|---|---|
| Molecular Weight | 283.28500 |
| Exact Mass | 283.10700 |
| PSA | 82.67000 |
| LogP | 0.57210 |
| InChIKey | VOXNDNHSERTDEB-UHFFFAOYSA-N |
| SMILES | CCn1c(=O)n(C)c(=O)c2nc(-c3ccccc3)nnc21 |
|
~84%
10-ethyl-8-meth... CAS#:42285-85-8 |
| Literature: Nagamatsu, Tomohisa; Yamasaki, Hirofumi Journal of the Chemical Society. Perkin Transactions 1, 2001 , # 2 p. 130 - 137 |
|
~84%
10-ethyl-8-meth... CAS#:42285-85-8 |
| Literature: Nagamatsu, Tomohisa; Yamasaki, Hirofumi Journal of the Chemical Society. Perkin Transactions 1, 2001 , # 2 p. 130 - 137 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-Ethyl-3-methyl-6-phenyl-7-azalumazin |
| 6-Phenyl-1-ethyl-3-methyl-7-azalumazin |