1,4-bis(2-methylprop-2-enoxy)benzene structure
|
Common Name | 1,4-bis(2-methylprop-2-enoxy)benzene | ||
|---|---|---|---|---|
| CAS Number | 42290-09-5 | Molecular Weight | 218.29200 | |
| Density | 0.964g/cm3 | Boiling Point | 316.9ºC at 760 mmHg | |
| Molecular Formula | C14H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 118.2ºC | |
| Name | 1,4-bis(2-methylprop-2-enoxy)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 0.964g/cm3 |
|---|---|
| Boiling Point | 316.9ºC at 760 mmHg |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.29200 |
| Flash Point | 118.2ºC |
| Exact Mass | 218.13100 |
| PSA | 18.46000 |
| LogP | 3.59640 |
| Index of Refraction | 1.499 |
| InChIKey | VMORTJGFHUXVAL-UHFFFAOYSA-N |
| SMILES | C=C(C)COc1ccc(OCC(=C)C)cc1 |
|
~%
1,4-bis(2-methy... CAS#:42290-09-5 |
| Literature: Roffia,P. et al. Journal of Organometallic Chemistry, 1973 , vol. 54, p. 357 - 360 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Hydrochinondimethallylether |
| 1,4-bis[(2-methylprop-2-en-1-yl)oxy]benzene |
| 1,4-bis(2-methylallyloxy)benzene |