1h,1h-perfluoro-1-dodecanol
1h,1h-perfluoro-1-dodecanol structure
|
Common Name | 1h,1h-perfluoro-1-dodecanol | ||
|---|---|---|---|---|
| CAS Number | 423-65-4 | Molecular Weight | 600.11500 | |
| Density | 1.714g/cm3 | Boiling Point | 224°C 740mm | |
| Molecular Formula | C12H3F23O | Melting Point | 111-113°C | |
| MSDS | N/A | Flash Point | 224°C/740mm | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecan-1-ol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.714g/cm3 |
|---|---|
| Boiling Point | 224°C 740mm |
| Melting Point | 111-113°C |
| Molecular Formula | C12H3F23O |
| Molecular Weight | 600.11500 |
| Flash Point | 224°C/740mm |
| Exact Mass | 599.98200 |
| PSA | 20.23000 |
| LogP | 6.89400 |
| Vapour Pressure | 0.0144mmHg at 25°C |
| Index of Refraction | 1.285 |
| InChIKey | SHTZQFTXUMCALC-UHFFFAOYSA-N |
| SMILES | OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | F: Flammable;Xi: Irritant; |
|---|---|
| Safety Phrases | S24/25 |
| HS Code | 2905590090 |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2905590090 |
|---|---|
| Summary | 2905590090 other halogenated, sulphonated, nitrated or nitrosated derivatives of acyclic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1H,1H-Perfluoro-1-dodecanol |
| 1H,1H-Tricosafluor-dodecan-1-ol |
| 1,1-Dihydroperfluordodecanol-1 |
| 1H,1H-tricosafluoro-dodecan-1-ol |
| 1h,1h-perfluorododecanol |
| 1H,1H-Perfluorododecan-1-ol |
| perfluorododecanol |
| PC9798 |
| MFCD00153235 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecan-1-ol? |
| A: Molecular formula of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecan-1-ol is C12H3F23O. |
| Q: What is the CAS number of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecan-1-ol? |
| A: CAS number of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecan-1-ol is 423-65-4. |
| Q: What is the polar surface area (PSA) of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecan-1-ol? |
| A: Polar surface area (PSA) of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecan-1-ol is 20.23000. |
| Q: What English synonyms does 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecan-1-ol have? |
| A: English synonyms of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecan-1-ol: 1H,1H-Perfluoro-1-dodecanol, 1H,1H-Tricosafluor-dodecan-1-ol, 1,1-Dihydroperfluordodecanol-1, 1H,1H-tricosafluoro-dodecan-1-ol, 1h,1h-perfluorododecanol, 1H,1H-Perfluorododecan-1-ol, perfluorododecanol, PC9798, MFCD00153235. |
| Q: What is the InChIKey of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecan-1-ol? |
| A: InChIKey of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecan-1-ol is SHTZQFTXUMCALC-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecan-1-ol? |
| A: SMILES notation of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecan-1-ol is OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F. |
| Q: What is the molecular weight of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecan-1-ol? |
| A: Molecular weight of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecan-1-ol is 600.11500. |
| Q: What is the boiling point of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecan-1-ol? |
| A: Boiling point of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecan-1-ol is 224°C 740mm. |
| Q: What is the melting point of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecan-1-ol? |
| A: Melting point of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecan-1-ol is 111-113°C. |
| Q: What is the LogP of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecan-1-ol? |
| A: LogP of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecan-1-ol is 6.89400. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |