9h-hexadecafluorononanoyl chloride
Modify Date: 2025-08-25 13:20:41
9h-hexadecafluorononanoyl chloride structure
|
Common Name | 9h-hexadecafluorononanoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 423-95-0 | Molecular Weight | 464.53100 | |
| Density | 1,803 g/cm3 | Boiling Point | 166 °C | |
| Molecular Formula | C9HClF16O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 58.8ºC | |
| Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1,803 g/cm3 |
|---|---|
| Boiling Point | 166 °C |
| Molecular Formula | C9HClF16O |
| Molecular Weight | 464.53100 |
| Flash Point | 58.8ºC |
| Exact Mass | 463.94600 |
| PSA | 17.07000 |
| LogP | 5.46400 |
| Vapour Pressure | 1.26mmHg at 25°C |
| Index of Refraction | 1.322 |
| InChIKey | RJYUFWDUKZUCSP-UHFFFAOYSA-N |
| SMILES | O=C(Cl)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| Hazard Codes | C: Corrosive; |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | 3265 |
| HS Code | 2915900090 |
|
~%
9h-hexadecafluo... CAS#:423-95-0 |
| Literature: Du Pont de Nemours and Co. Patent: US2646449 , 1950 ; Full Text Show Details Du Pont de Nemours and Co. Patent: US2559630 , 1950 ; |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:23453-64-7| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| EINECS 207-033-1 |
| Hexadecafluor-9H-nonansaeurechlorid |
| 9h-perfluorononanoyl chloride |
| MFCD00042120 |
| 9H-Hexadecafluor-nonanoylchlorid |
| 9H-Hexadecafluorononanoyl chloride |
| PC4532 |