1-Cyclopentene-1-aceticacid, 5-oxo-2-(5,6,7,8-tetrahydro-2-naphthalenyl)- structure
|
Common Name | 1-Cyclopentene-1-aceticacid, 5-oxo-2-(5,6,7,8-tetrahydro-2-naphthalenyl)- | ||
|---|---|---|---|---|
| CAS Number | 42349-21-3 | Molecular Weight | 270.32300 | |
| Density | 1.241g/cm3 | Boiling Point | 445.1ºC at 760 mmHg | |
| Molecular Formula | C17H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.1ºC | |
| Name | 2-[5-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-yl)cyclopenten-1-yl]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.241g/cm3 |
|---|---|
| Boiling Point | 445.1ºC at 760 mmHg |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.32300 |
| Flash Point | 237.1ºC |
| Exact Mass | 270.12600 |
| PSA | 54.37000 |
| LogP | 3.15660 |
| Index of Refraction | 1.604 |
| InChIKey | HMCVHWBJGDXPFX-UHFFFAOYSA-N |
| SMILES | O=C(O)CC1=C(c2ccc3c(c2)CCCC3)CCC1=O |
|
~%
1-Cyclopentene-... CAS#:42349-21-3 |
| Literature: Turner Journal of the American Chemical Society, 1953 , vol. 75, p. 1257 |
|
~%
1-Cyclopentene-... CAS#:42349-21-3 |
| Literature: Turner Journal of the American Chemical Society, 1953 , vol. 75, p. 1257 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| [5-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-yl)cyclopent-1-en-1-yl]acetic acid |
| [5-Oxo-2-(5,6,7,8-tetrahydro-[2]naphthyl)-cyclopent-1-enyl]-essigsaeure |
| [5-oxo-2-(5,6,7,8-tetrahydro-[2]naphthyl)-cyclopent-1-enyl]-acetic acid |