1,2-Ethanediol, 2-(4-methoxyphenyl)-1,1-diphenyl
Modify Date: 2025-09-07 23:23:01
1,2-Ethanediol, 2-(4-methoxyphenyl)-1,1-diphenyl structure
|
Common Name | 1,2-Ethanediol, 2-(4-methoxyphenyl)-1,1-diphenyl | ||
|---|---|---|---|---|
| CAS Number | 4237-52-9 | Molecular Weight | 320.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2-Ethanediol, 2-(4-methoxyphenyl)-1,1-diphenyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H20O3 |
|---|---|
| Molecular Weight | 320.4 |
| InChIKey | UGSRBVXUDKDNFW-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(O)C(O)(c2ccccc2)c2ccccc2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1,2-Ethanediol, 2-(4-methoxyphenyl)-1,1-diphenyl? |
| A: SMILES notation of 1,2-Ethanediol, 2-(4-methoxyphenyl)-1,1-diphenyl is COc1ccc(C(O)C(O)(c2ccccc2)c2ccccc2)cc1. |
| Q: What is the molecular formula of 1,2-Ethanediol, 2-(4-methoxyphenyl)-1,1-diphenyl? |
| A: Molecular formula of 1,2-Ethanediol, 2-(4-methoxyphenyl)-1,1-diphenyl is C21H20O3. |
| Q: What is the InChIKey of 1,2-Ethanediol, 2-(4-methoxyphenyl)-1,1-diphenyl? |
| A: InChIKey of 1,2-Ethanediol, 2-(4-methoxyphenyl)-1,1-diphenyl is UGSRBVXUDKDNFW-UHFFFAOYSA-N. |
| Q: What is the English name of 1,2-Ethanediol, 2-(4-methoxyphenyl)-1,1-diphenyl? |
| A: The English name of 1,2-Ethanediol, 2-(4-methoxyphenyl)-1,1-diphenyl is 1,2-Ethanediol, 2-(4-methoxyphenyl)-1,1-diphenyl. |
| Q: What is the molecular weight of 1,2-Ethanediol, 2-(4-methoxyphenyl)-1,1-diphenyl? |
| A: Molecular weight of 1,2-Ethanediol, 2-(4-methoxyphenyl)-1,1-diphenyl is 320.4. |
| Q: What is the CAS number of 1,2-Ethanediol, 2-(4-methoxyphenyl)-1,1-diphenyl? |
| A: CAS number of 1,2-Ethanediol, 2-(4-methoxyphenyl)-1,1-diphenyl is 4237-52-9. |
| Q: What is the Chinese name of 4237-52-9? |
| A: Chinese name of 4237-52-9 is 4237-52-9. |