5-Bromo-2-[(4-fluorobenzyl)oxy]benzaldehyde structure
|
Common Name | 5-Bromo-2-[(4-fluorobenzyl)oxy]benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 423724-34-9 | Molecular Weight | 309.13000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10BrFO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-Bromo-2-[(4-fluorobenzyl)oxy]benzaldehyde |
|---|
| Molecular Formula | C14H10BrFO2 |
|---|---|
| Molecular Weight | 309.13000 |
| Exact Mass | 307.98500 |
| PSA | 26.30000 |
| LogP | 3.97970 |
| InChIKey | HBVGTRXZCYYPHM-UHFFFAOYSA-N |
| SMILES | O=Cc1cc(Br)ccc1OCc1ccc(F)cc1 |
| HS Code | 2913000090 |
|---|
|
~99%
5-Bromo-2-[(4-f... CAS#:423724-34-9 |
| Literature: Bhattarai, Bharat Raj; Kafle, Bhooshan; Hwang, Ji-Sun; Khadka, Deegendra; Lee, Sun-Myung; Kang, Jae-Seung; Ham, Seung Wook; Han, Inn-Oc; Park, Hwangseo; Cho, Hyeongjin Bioorganic and Medicinal Chemistry Letters, 2009 , vol. 19, # 21 p. 6161 - 6165 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |