3-(2-methylphenyl)-4-prop-2-enyl-1H-1,2,4-triazole-5-thione structure
|
Common Name | 3-(2-methylphenyl)-4-prop-2-enyl-1H-1,2,4-triazole-5-thione | ||
|---|---|---|---|---|
| CAS Number | 423741-70-2 | Molecular Weight | 231.31700 | |
| Density | 1.18g/cm3 | Boiling Point | 323.1ºC at 760 mmHg | |
| Molecular Formula | C12H13N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 149.2ºC | |
| Name | 3-(2-methylphenyl)-4-prop-2-enyl-1H-1,2,4-triazole-5-thione |
|---|
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 323.1ºC at 760 mmHg |
| Molecular Formula | C12H13N3S |
| Molecular Weight | 231.31700 |
| Flash Point | 149.2ºC |
| Exact Mass | 231.08300 |
| PSA | 69.51000 |
| LogP | 2.72820 |
| Index of Refraction | 1.63 |
| InChIKey | BOKMEJQLNQDLIT-UHFFFAOYSA-N |
| SMILES | C=CCn1c(-c2ccccc2C)n[nH]c1=S |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |