dimethyl butane-1,4-disulfonate structure
|
Common Name | dimethyl butane-1,4-disulfonate | ||
|---|---|---|---|---|
| CAS Number | 4239-21-8 | Molecular Weight | 246.30200 | |
| Density | 1.35g/cm3 | Boiling Point | 454.7ºC at 760 mmHg | |
| Molecular Formula | C6H14O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.8ºC | |
| Name | dimethyl butane-1,4-disulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 454.7ºC at 760 mmHg |
| Molecular Formula | C6H14O6S2 |
| Molecular Weight | 246.30200 |
| Flash Point | 228.8ºC |
| Exact Mass | 246.02300 |
| PSA | 103.50000 |
| LogP | 1.88060 |
| Index of Refraction | 1.47 |
| InChIKey | TTXMTFUPSPPMTK-UHFFFAOYSA-N |
| SMILES | COS(=O)(=O)CCCCS(=O)(=O)OC |
| HS Code | 2905199090 |
|---|
|
~%
dimethyl butane... CAS#:4239-21-8 |
| Literature: Johnston,T.P. et al. Journal of Organic Chemistry, 1960 , vol. 25, p. 399 - 402 |
|
~%
dimethyl butane... CAS#:4239-21-8 |
| Literature: Ross; Davis Journal of the Chemical Society, 1957 , p. 2420 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2905199090 |
|---|---|
| Summary | 2905199090. saturated monohydric alcohols. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| butane-1,4-disulfonic acid dimethyl ester |
| Butan-1,4-disulfonsaeure-dimethylester |
| 1,4-Butanedisulfonic acid,dimethyl ester |
| SRI 916 |