1,6-Bis(mesyloxy)hexane structure
|
Common Name | 1,6-Bis(mesyloxy)hexane | ||
|---|---|---|---|---|
| CAS Number | 4239-24-1 | Molecular Weight | 274.35500 | |
| Density | 1.273g/cm3 | Boiling Point | 474.6ºC at 760 mmHg | |
| Molecular Formula | C8H18O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.8ºC | |
Use of 1,6-Bis(mesyloxy)hexane16-Bismesyloxyhexane is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | 6-methylsulfonyloxyhexyl methanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Description | 16-Bismesyloxyhexane is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. |
| References |
| Density | 1.273g/cm3 |
|---|---|
| Boiling Point | 474.6ºC at 760 mmHg |
| Molecular Formula | C8H18O6S2 |
| Molecular Weight | 274.35500 |
| Flash Point | 240.8ºC |
| Exact Mass | 274.05400 |
| PSA | 103.50000 |
| LogP | 2.66080 |
| Index of Refraction | 1.471 |
| InChIKey | WZOJEWBBWCYINS-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OCCCCCCOS(C)(=O)=O |
|
~92%
1,6-Bis(mesylox... CAS#:4239-24-1 |
| Literature: Li, Yi; Hesse, Manfred Helvetica Chimica Acta, 2003 , vol. 86, # 2 p. 310 - 323 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 1,6-hexanediyl dimethanesulfonate |
| Hexane dimethanesulphonate |
| hexamethylene dimesylate |
| CTK8I7029 |
| 1,6-Bis(mesyloxy)hexane |
| hexane-1,6-diyl bis[methanesulfonate] |
| 1,6-bis-methanesulfonyloxy-hexane |
| 1,6-hexyl dimesylate |
| 1,6-Hexanediol,dimethanesulfonate |
| AC1L3RSR |
| Hexasulphan |
| 1,6-Bis-methansulfonyloxy-hexan |
| Hexasulfan |