1-Butanone,2,2,3,3,4,4,4-heptafluoro-1-(1-pyrrolidinyl)- structure
|
Common Name | 1-Butanone,2,2,3,3,4,4,4-heptafluoro-1-(1-pyrrolidinyl)- | ||
|---|---|---|---|---|
| CAS Number | 424-54-4 | Molecular Weight | 267.14400 | |
| Density | 1.465g/cm3 | Boiling Point | 220.9ºC at 760mmHg | |
| Molecular Formula | C8H8F7NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 87.4ºC | |
| Name | 2,2,3,3,4,4,4-heptafluoro-1-pyrrolidin-1-ylbutan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.465g/cm3 |
|---|---|
| Boiling Point | 220.9ºC at 760mmHg |
| Molecular Formula | C8H8F7NO |
| Molecular Weight | 267.14400 |
| Flash Point | 87.4ºC |
| Exact Mass | 267.04900 |
| PSA | 20.31000 |
| LogP | 2.37960 |
| Vapour Pressure | 0.11mmHg at 25°C |
| Index of Refraction | 1.372 |
| InChIKey | CIAFXLYUEVKNBA-UHFFFAOYSA-N |
| SMILES | O=C(N1CCCC1)C(F)(F)C(F)(F)C(F)(F)F |
|
~%
1-Butanone,2,2,... CAS#:424-54-4 |
| Literature: Katritzky; He; Suzuki Journal of Organic Chemistry, 2000 , vol. 65, # 24 p. 8210 - 8213 |
|
~%
1-Butanone,2,2,... CAS#:424-54-4 |
| Literature: Joullie Journal of the American Chemical Society, 1955 , vol. 77, p. 6662 |
| 1-Heptafluorbutyryl-pyrrolidin |
| 1-heptafluorobutyryl-pyrrolidine |