sodium 5-chloro-2-(2,4-dichlorophenoxy)phenolate structure
|
Common Name | sodium 5-chloro-2-(2,4-dichlorophenoxy)phenolate | ||
|---|---|---|---|---|
| CAS Number | 42409-10-9 | Molecular Weight | 311.52400 | |
| Density | N/A | Boiling Point | 344.6ºC at 760 mmHg | |
| Molecular Formula | C12H6Cl3NaO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.2ºC | |
| Name | sodium,5-chloro-2-(2,4-dichlorophenoxy)phenolate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 344.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C12H6Cl3NaO2 |
| Molecular Weight | 311.52400 |
| Flash Point | 162.2ºC |
| Exact Mass | 309.93300 |
| PSA | 32.29000 |
| LogP | 5.58290 |
| InChIKey | XJYNZWIMJRIQSZ-UHFFFAOYSA-M |
| SMILES | [Na+].[O-]c1cc(Cl)ccc1Oc1ccc(Cl)cc1Cl |
| HS Code | 2918990090 |
|---|
|
~%
sodium 5-chloro... CAS#:42409-10-9 |
| Literature: Shalaby, Shalaby W. Patent: US2005/118240 A1, 2005 ; Location in patent: Page/Page column 3 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| triclosan sodium salt |
| phenate salt |
| EINECS 255-809-3 |