Cbz-N-methyl-L-valine structure
|
Common Name | Cbz-N-methyl-L-valine | ||
|---|---|---|---|---|
| CAS Number | 42417-65-2 | Molecular Weight | 131.173 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 206.9±23.0 °C at 760 mmHg | |
| Molecular Formula | C6H13NO2 | Melting Point | 68-70 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 78.9±22.6 °C | |
Use of Cbz-N-methyl-L-valineN-((Benzyloxy)carbonyl)-N-methyl-L-valine is a valine derivative[1]. |
| Name | (2S)-3-methyl-2-[methyl(phenylmethoxycarbonyl)amino]butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | N-((Benzyloxy)carbonyl)-N-methyl-L-valine is a valine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 206.9±23.0 °C at 760 mmHg |
| Melting Point | 68-70 °C(lit.) |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.173 |
| Flash Point | 78.9±22.6 °C |
| Exact Mass | 131.094635 |
| PSA | 66.84000 |
| LogP | 0.43 |
| Vapour Pressure | 0.1±0.8 mmHg at 25°C |
| Index of Refraction | 1.443 |
| InChIKey | NNEHOKZDWLJKHP-LBPRGKRZSA-N |
| SMILES | CC(C)C(C(=O)O)N(C)C(=O)OCc1ccccc1 |
| Storage condition | Store at RT. |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S36/37 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2922509090 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-benzyloxycarbonyl-N-methyl-L-valine |
| (2S)-3-methyl-2-(methyl{[(phenylmethyl)oxy]carbonyl}amino)butanoic acid |
| Cbz-MeVal-OH |
| Z-N-methyl-L-valine |
| AmbotzZAA1019 |
| Z-N-Me-Val-OH |
| H-L-MEVAL-OH HCL |
| (S)-3-Methyl-2-(methylamino)butyric acid,N-Me-Val-OH |
| N-Methyl-L-valine |
| H-MEVAL-OH |
| N-Methylvaline |
| N-[(Benzyloxy)carbonyl]-N-methyl-L-valine |
| (S)-N-(Benzyloxycarbonyl)-N-methylvaline |
| (S)-N-methyl-N-(benzyloxycarbonyl)valine |
| N-ME-VALINE |
| Cbz-NMeVal-OH |
| H-MEVAL-OH HCL |
| MFCD00153397 |
| N-Me-Val-OH |
| Cbz-N-methyl-L-valine |
| N-Cbz-N-methyl-L-valine |
| Benzyloxycarbonyl-N-methyl-L-valine |