Cbz-N-methyl-L-valine
Cbz-N-methyl-L-valine structure
|
Common Name | Cbz-N-methyl-L-valine | ||
|---|---|---|---|---|
| CAS Number | 42417-65-2 | Molecular Weight | 131.173 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 206.9±23.0 °C at 760 mmHg | |
| Molecular Formula | C6H13NO2 | Melting Point | 68-70 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 78.9±22.6 °C | |
Use of Cbz-N-methyl-L-valineN-((Benzyloxy)carbonyl)-N-methyl-L-valine is a valine derivative[1]. |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2S)-3-methyl-2-[methyl(phenylmethoxycarbonyl)amino]butanoic acid |
|---|---|
| Synonym | More Synonyms |
This table contains bioactivity, target information and biological‑assay experimental data of this compound.
| Description | N-((Benzyloxy)carbonyl)-N-methyl-L-valine is a valine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 206.9±23.0 °C at 760 mmHg |
| Melting Point | 68-70 °C(lit.) |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.173 |
| Flash Point | 78.9±22.6 °C |
| Exact Mass | 131.094635 |
| PSA | 66.84000 |
| LogP | 0.43 |
| Vapour Pressure | 0.1±0.8 mmHg at 25°C |
| Index of Refraction | 1.443 |
| InChIKey | NNEHOKZDWLJKHP-LBPRGKRZSA-N |
| SMILES | CC(C)C(C(=O)O)N(C)C(=O)OCc1ccccc1 |
| Storage condition | Store at RT. |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S36/37 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2922509090 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 6 | |
|---|---|
| DownStream 1 | |
CAS#:1149-26-4
CAS#:74-88-4
CAS#:66866-64-6
CAS#:2480-23-1
CAS#:501-53-1![N-[(Benzyloxy)carbonyl]-N-methylvaline Structure](https://image.chemsrc.com/caspic/343/92619-25-5.png)
CAS#:92619-25-5
CAS#:3339-44-4This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-benzyloxycarbonyl-N-methyl-L-valine |
| (2S)-3-methyl-2-(methyl{[(phenylmethyl)oxy]carbonyl}amino)butanoic acid |
| Cbz-MeVal-OH |
| Z-N-methyl-L-valine |
| AmbotzZAA1019 |
| Z-N-Me-Val-OH |
| H-L-MEVAL-OH HCL |
| (S)-3-Methyl-2-(methylamino)butyric acid,N-Me-Val-OH |
| N-Methyl-L-valine |
| H-MEVAL-OH |
| N-Methylvaline |
| N-[(Benzyloxy)carbonyl]-N-methyl-L-valine |
| (S)-N-(Benzyloxycarbonyl)-N-methylvaline |
| (S)-N-methyl-N-(benzyloxycarbonyl)valine |
| N-ME-VALINE |
| Cbz-NMeVal-OH |
| H-MEVAL-OH HCL |
| MFCD00153397 |
| N-Me-Val-OH |
| Cbz-N-methyl-L-valine |
| N-Cbz-N-methyl-L-valine |
| Benzyloxycarbonyl-N-methyl-L-valine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the storage conditions for (2S)-3-methyl-2-[methyl(phenylmethoxycarbonyl)amino]butanoic acid? |
| A: Storage conditions for (2S)-3-methyl-2-[methyl(phenylmethoxycarbonyl)amino]butanoic acid: Store at RT. |
| Q: What is the CAS number of (2S)-3-methyl-2-[methyl(phenylmethoxycarbonyl)amino]butanoic acid? |
| A: CAS number of (2S)-3-methyl-2-[methyl(phenylmethoxycarbonyl)amino]butanoic acid is 42417-65-2. |
| Q: What is the melting point of (2S)-3-methyl-2-[methyl(phenylmethoxycarbonyl)amino]butanoic acid? |
| A: Melting point of (2S)-3-methyl-2-[methyl(phenylmethoxycarbonyl)amino]butanoic acid is 68-70 °C(lit.). |
| Q: What is the English name of (2S)-3-methyl-2-[methyl(phenylmethoxycarbonyl)amino]butanoic acid? |
| A: The English name of (2S)-3-methyl-2-[methyl(phenylmethoxycarbonyl)amino]butanoic acid is (2S)-3-methyl-2-[methyl(phenylmethoxycarbonyl)amino]butanoic acid. |
| Q: What is the boiling point of (2S)-3-methyl-2-[methyl(phenylmethoxycarbonyl)amino]butanoic acid? |
| A: Boiling point of (2S)-3-methyl-2-[methyl(phenylmethoxycarbonyl)amino]butanoic acid is 206.9±23.0 °C at 760 mmHg. |
| Q: What is the SMILES notation of (2S)-3-methyl-2-[methyl(phenylmethoxycarbonyl)amino]butanoic acid? |
| A: SMILES notation of (2S)-3-methyl-2-[methyl(phenylmethoxycarbonyl)amino]butanoic acid is CC(C)C(C(=O)O)N(C)C(=O)OCc1ccccc1. |
| Q: What is the polar surface area (PSA) of (2S)-3-methyl-2-[methyl(phenylmethoxycarbonyl)amino]butanoic acid? |
| A: Polar surface area (PSA) of (2S)-3-methyl-2-[methyl(phenylmethoxycarbonyl)amino]butanoic acid is 66.84000. |
| Q: What are the downstream products of (2S)-3-methyl-2-[methyl(phenylmethoxycarbonyl)amino]butanoic acid? |
| A: Related downstream products(CAS) of (2S)-3-methyl-2-[methyl(phenylmethoxycarbonyl)amino]butanoic acid: 3339-44-4. |
| Q: What is the molecular weight of (2S)-3-methyl-2-[methyl(phenylmethoxycarbonyl)amino]butanoic acid? |
| A: Molecular weight of (2S)-3-methyl-2-[methyl(phenylmethoxycarbonyl)amino]butanoic acid is 131.173. |
| Q: What is the safety information for (2S)-3-methyl-2-[methyl(phenylmethoxycarbonyl)amino]butanoic acid? |
| A: Safety information for (2S)-3-methyl-2-[methyl(phenylmethoxycarbonyl)amino]butanoic acid: S36/37. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |