diethyl piperazine-1,4-dipropionate structure
|
Common Name | diethyl piperazine-1,4-dipropionate | ||
|---|---|---|---|---|
| CAS Number | 42434-17-3 | Molecular Weight | 286.36700 | |
| Density | 1.061g/cm3 | Boiling Point | 370.6ºC at 760mmHg | |
| Molecular Formula | C14H26N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.9ºC | |
| Name | ethyl 3-[4-(3-ethoxy-3-oxopropyl)piperazin-1-yl]propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.061g/cm3 |
|---|---|
| Boiling Point | 370.6ºC at 760mmHg |
| Molecular Formula | C14H26N2O4 |
| Molecular Weight | 286.36700 |
| Flash Point | 177.9ºC |
| Exact Mass | 286.18900 |
| PSA | 59.08000 |
| LogP | 0.38620 |
| Index of Refraction | 1.472 |
| InChIKey | NHSDIZSYJOGUJB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCN1CCN(CCC(=O)OCC)CC1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Diethyl piperazine-1,4-dipropionate |
| 1,4-Piperazinedipropanoicacid,1,4-diethyl ester |
| EINECS 255-819-8 |