4,4'-carbonimidoylbis[N,N-diethylaniline]
Modify Date: 2025-09-18 16:43:34
![4,4'-carbonimidoylbis[N,N-diethylaniline] Structure](https://image.chemsrc.com/caspic/236/42450-16-8.png)
4,4'-carbonimidoylbis[N,N-diethylaniline] structure
|
Common Name | 4,4'-carbonimidoylbis[N,N-diethylaniline] | ||
|---|---|---|---|---|
| CAS Number | 42450-16-8 | Molecular Weight | 323.47500 | |
| Density | 0.98g/cm3 | Boiling Point | 457.8ºC at 760 mmHg | |
| Molecular Formula | C21H29N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.7ºC | |
| Name | 4-[4-(diethylamino)benzenecarboximidoyl]-N,N-diethylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 0.98g/cm3 |
|---|---|
| Boiling Point | 457.8ºC at 760 mmHg |
| Molecular Formula | C21H29N3 |
| Molecular Weight | 323.47500 |
| Flash Point | 230.7ºC |
| Exact Mass | 323.23600 |
| PSA | 30.33000 |
| LogP | 4.89490 |
| Index of Refraction | 1.541 |
| InChIKey | HPKYMNAXAKNZCR-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc(C(=N)c2ccc(N(CC)CC)cc2)cc1 |
| HS Code | 2925290090 |
|---|
|
~%
4,4'-carbonimid... CAS#:42450-16-8 |
| Literature: Lynch; Reid Journal of the American Chemical Society, 1933 , vol. 55, p. 2515,2518 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4,4'-Bis-diaethylamino-benzophenon-imin |
| 4,4'-bis-diethylamino-benzophenone-imine |
| EINECS 255-829-2 |