1-(2-Amino-3,4,5-trimethoxyphenyl)ethanone structure
|
Common Name | 1-(2-Amino-3,4,5-trimethoxyphenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 42465-69-0 | Molecular Weight | 225.24100 | |
| Density | 1.153g/cm3 | Boiling Point | 354ºC at 760mmHg | |
| Molecular Formula | C11H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.3ºC | |
| Name | 1-(2-Amino-3,4,5-trimethoxyphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.153g/cm3 |
|---|---|
| Boiling Point | 354ºC at 760mmHg |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24100 |
| Flash Point | 162.3ºC |
| Exact Mass | 225.10000 |
| PSA | 70.78000 |
| LogP | 2.07840 |
| Index of Refraction | 1.533 |
| InChIKey | OSCPZOWTABJKLB-UHFFFAOYSA-N |
| SMILES | COc1cc(C(C)=O)c(N)c(OC)c1OC |
| Storage condition | 2-8°C |
| HS Code | 2922509090 |
|---|
|
~%
1-(2-Amino-3,4,... CAS#:42465-69-0 |
| Literature: Journal of Heterocyclic Chemistry, , vol. 17, # 7 p. 1489 - 1495 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD11109872 |