2-hydroxy-1,2-bis(3,4,5-trimethoxyphenyl)ethanone structure
|
Common Name | 2-hydroxy-1,2-bis(3,4,5-trimethoxyphenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 7467-90-5 | Molecular Weight | 392.40000 | |
| Density | 1.211g/cm3 | Boiling Point | 535.6ºC at 760 mmHg | |
| Molecular Formula | C20H24O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.2ºC | |
| Name | 2-hydroxy-1,2-bis(3,4,5-trimethoxyphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.211g/cm3 |
|---|---|
| Boiling Point | 535.6ºC at 760 mmHg |
| Molecular Formula | C20H24O8 |
| Molecular Weight | 392.40000 |
| Flash Point | 184.2ºC |
| Exact Mass | 392.14700 |
| PSA | 92.68000 |
| LogP | 2.65450 |
| Index of Refraction | 1.544 |
| InChIKey | JIDNYUKRPUJZAL-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)C(O)c2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| HS Code | 2914509090 |
|---|
|
~%
2-hydroxy-1,2-b... CAS#:7467-90-5 |
| Literature: Richtzenhain Chemische Berichte, 1944 , vol. 77/79, p. 409,416 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3,4,5,3',4',5'-Hexamethoxy-benzoin |
| 3,3',4,4',5,5'-HEXAMETHOXYBENZOIN |