2-(4-methoxyphenyl)-1,3-oxazole-4,5-dicarboxamide
Modify Date: 2025-09-20 21:37:20
2-(4-methoxyphenyl)-1,3-oxazole-4,5-dicarboxamide structure
|
Common Name | 2-(4-methoxyphenyl)-1,3-oxazole-4,5-dicarboxamide | ||
|---|---|---|---|---|
| CAS Number | 42469-49-8 | Molecular Weight | 261.23300 | |
| Density | 1.359g/cm3 | Boiling Point | 571.3ºC at 760 mmHg | |
| Molecular Formula | C12H11N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 299.3ºC | |
| Name | 2-(4-methoxyphenyl)-1,3-oxazole-4,5-dicarboxamide |
|---|
| Density | 1.359g/cm3 |
|---|---|
| Boiling Point | 571.3ºC at 760 mmHg |
| Molecular Formula | C12H11N3O4 |
| Molecular Weight | 261.23300 |
| Flash Point | 299.3ºC |
| Exact Mass | 261.07500 |
| PSA | 123.42000 |
| LogP | 2.31640 |
| Index of Refraction | 1.6 |
| InChIKey | OCHCYYAMTRZGLE-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2nc(C(N)=O)c(C(N)=O)o2)cc1 |
| HS Code | 2934999090 |
|---|
|
~%
2-(4-methoxyphe... CAS#:42469-49-8 |
| Literature: Tarzia,G. et al. European Journal of Medicinal Chemistry, 1976 , vol. 11, p. 263 - 270 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |