2-(4-fluorophenyl)-1,3-oxazole-4,5-dicarboxamide structure
|
Common Name | 2-(4-fluorophenyl)-1,3-oxazole-4,5-dicarboxamide | ||
|---|---|---|---|---|
| CAS Number | 42469-50-1 | Molecular Weight | 249.19800 | |
| Density | 1.445g/cm3 | Boiling Point | 541.8ºC at 760 mmHg | |
| Molecular Formula | C11H8FN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.4ºC | |
| Name | 2-(4-fluorophenyl)-1,3-oxazole-4,5-dicarboxamide |
|---|
| Density | 1.445g/cm3 |
|---|---|
| Boiling Point | 541.8ºC at 760 mmHg |
| Molecular Formula | C11H8FN3O3 |
| Molecular Weight | 249.19800 |
| Flash Point | 281.4ºC |
| Exact Mass | 249.05500 |
| PSA | 114.19000 |
| LogP | 2.44690 |
| Index of Refraction | 1.601 |
| InChIKey | YWAZSEXAEKVKJT-UHFFFAOYSA-N |
| SMILES | NC(=O)c1nc(-c2ccc(F)cc2)oc1C(N)=O |
| HS Code | 2934999090 |
|---|
|
~%
2-(4-fluorophen... CAS#:42469-50-1 |
| Literature: Tarzia,G. et al. European Journal of Medicinal Chemistry, 1976 , vol. 11, p. 263 - 270 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |