Urea,N-(2-chloroethyl)-N-nitroso-N'-(3-pyridinylmethyl)- structure
|
Common Name | Urea,N-(2-chloroethyl)-N-nitroso-N'-(3-pyridinylmethyl)- | ||
|---|---|---|---|---|
| CAS Number | 42471-22-7 | Molecular Weight | 242.66200 | |
| Density | 1.36g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H11ClN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2-chloroethyl)-1-nitroso-3-(pyridin-3-ylmethyl)urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Molecular Formula | C9H11ClN4O2 |
| Molecular Weight | 242.66200 |
| Exact Mass | 242.05700 |
| PSA | 74.66000 |
| LogP | 1.90430 |
| Index of Refraction | 1.6 |
| InChIKey | LXYDRKACMKCOJS-UHFFFAOYSA-N |
| SMILES | O=NN(CCCl)C(=O)NCc1cccnc1 |
|
~%
Urea,N-(2-chlor... CAS#:42471-22-7 |
| Literature: Sankyo Company Limited Patent: US4003901 A1, 1977 ; |
|
~57%
Urea,N-(2-chlor... CAS#:42471-22-7 |
| Literature: Sueyoshi, Shoko; Kamiya, Shozo Chemical and Pharmaceutical Bulletin, 1981 , vol. 29, # 5 p. 1267 - 1273 |
|
~32%
Urea,N-(2-chlor... CAS#:42471-22-7 |
| Literature: Sueyoshi, Shoko; Kamiya, Shozo Chemical and Pharmaceutical Bulletin, 1981 , vol. 29, # 5 p. 1267 - 1273 |
| 1-(2-Chlorethyl)-1-nitroso-3-(3-pyridyl)methylharnstoff |
| 1-(2-chloro-ethyl)-1-nitroso-3-pyridin-3-ylmethyl-urea |
| 1-(2-Chlorethyl)-1-nitroso-3-(3-pyridylmethyl)-urea |
| 1-(2-chloroethyl)-1-nitroso-3-(3-pyridylmethyl)urea |