2,3-Butanedione,2,3-di-2-methyl-2-phenylhydrazone structure
|
Common Name | 2,3-Butanedione,2,3-di-2-methyl-2-phenylhydrazone | ||
|---|---|---|---|---|
| CAS Number | 42479-40-3 | Molecular Weight | 294.39400 | |
| Density | 1g/cm3 | Boiling Point | 405.8ºC at 760mmHg | |
| Molecular Formula | C18H22N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.2ºC | |
| Name | N-methyl-N-[(E)-[(3Z)-3-[methyl(phenyl)hydrazinylidene]butan-2-ylidene]amino]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1g/cm3 |
|---|---|
| Boiling Point | 405.8ºC at 760mmHg |
| Molecular Formula | C18H22N4 |
| Molecular Weight | 294.39400 |
| Flash Point | 199.2ºC |
| Exact Mass | 294.18400 |
| PSA | 31.20000 |
| LogP | 4.01100 |
| Index of Refraction | 1.553 |
| InChIKey | GAZUJKJJBRIPLV-VBGLAJCLSA-N |
| SMILES | CC(=NN(C)c1ccccc1)C(C)=NN(C)c1ccccc1 |
|
~%
2,3-Butanedione... CAS#:42479-40-3 |
| Literature: Votocek Collection of Czechoslovak Chemical Communications, 1930 , vol. 2, p. 681,688 |
|
~%
2,3-Butanedione... CAS#:42479-40-3 |
| Literature: Votocek Collection of Czechoslovak Chemical Communications, 1930 , vol. 2, p. 681,688 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N,N'-Tetramethylglyoxalosazon |